C23H31ClFN5O2S — CID 169255745
butyl (7S)-18-chloro-14-ethylsulfanyl-17-fluoro-2-methyl-8,11,13,15,19-pentazatetracyclo[10.7.1.04,7.016,20]icosa-1(19),12,14,16(20),17-pentaene-8-carboxylate (PubChem CID 169255745) has the molecular formula C23H31ClFN5O2S and a molecular weight of 496.05 g/mol. Its IUPAC name is butyl (7S)-18-chloro-14-ethylsulfanyl-17-fluoro-2-methyl-8,11,13,15,19-pentazatetracyclo[10.7.1.04,7.016,20]icosa-1(19),12,14,16(20),17-pentaene-8-carboxylate.
| Compound Name | butyl (7S)-18-chloro-14-ethylsulfanyl-17-fluoro-2-methyl-8,11,13,15,19-pentazatetracyclo[10.7.1.04,7.016,20]icosa-1(19),12,14,16(20),17-pentaene-8-carboxylate |
|---|---|
| PubChem CID | 169255745 |
| Molecular Formula | C23H31ClFN5O2S |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | butyl (7S)-18-chloro-14-ethylsulfanyl-17-fluoro-2-methyl-8,11,13,15,19-pentazatetracyclo[10.7.1.04,7.016,20]icosa-1(19),12,14,16(20),17-pentaene-8-carboxylate |
| SMILES | CCCCOC(=O)N1CCNc2nc(SCC)nc3c(F)c(Cl)nc(c23)C(C)CC2CC[C@@H]21 |
| InChI | InChI=1S/C23H31ClFN5O2S/c1-4-6-11-32-23(31)30-10-9-26-21-16-18(13(3)12-14-7-8-15(14)30)27-20(24)17(25)19(16)28-22(29-21)33-5-2/h13-15H,4-12H2,1-3H3,(H,26,28,29)/t13?,14?,15-/m0/s1 |
| InChIKey | UMGNPHRAFRXCSD-NRXISQOPSA-N |
| XLogP | 5.87 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|