C24H37ClFN5O4S — CID 169255782
tert-butyl N-[6-(4-amino-7-chloro-2-ethylsulfonyl-8-fluoropyrido[4,3-d]pyrimidin-5-yl)hexyl]-N-butylcarbamate (PubChem CID 169255782) has the molecular formula C24H37ClFN5O4S and a molecular weight of 546.11 g/mol. Its IUPAC name is tert-butyl N-[6-(4-amino-7-chloro-2-ethylsulfonyl-8-fluoropyrido[4,3-d]pyrimidin-5-yl)hexyl]-N-butylcarbamate.
| Compound Name | tert-butyl N-[6-(4-amino-7-chloro-2-ethylsulfonyl-8-fluoropyrido[4,3-d]pyrimidin-5-yl)hexyl]-N-butylcarbamate |
|---|---|
| PubChem CID | 169255782 |
| Molecular Formula | C24H37ClFN5O4S |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | tert-butyl N-[6-(4-amino-7-chloro-2-ethylsulfonyl-8-fluoropyrido[4,3-d]pyrimidin-5-yl)hexyl]-N-butylcarbamate |
| SMILES | CCCCN(CCCCCCc1nc(Cl)c(F)c2nc(S(=O)(=O)CC)nc(N)c12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H37ClFN5O4S/c1-6-8-14-31(23(32)35-24(3,4)5)15-12-10-9-11-13-16-17-19(18(26)20(25)28-16)29-22(30-21(17)27)36(33,34)7-2/h6-15H2,1-5H3,(H2,27,29,30) |
| InChIKey | JHUHQGZDCGPCNQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|