C17H23ClFN5S — CID 169255988
5-[2-(azepan-3-yl)ethyl]-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-amine (PubChem CID 169255988) has the molecular formula C17H23ClFN5S and a molecular weight of 383.92 g/mol. Its IUPAC name is 5-[2-(azepan-3-yl)ethyl]-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 5-[2-(azepan-3-yl)ethyl]-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 169255988 |
| Molecular Formula | C17H23ClFN5S |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 5-[2-(azepan-3-yl)ethyl]-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CCSc1nc(N)c2c(CCC3CCCCNC3)nc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C17H23ClFN5S/c1-2-25-17-23-14-12(16(20)24-17)11(22-15(18)13(14)19)7-6-10-5-3-4-8-21-9-10/h10,21H,2-9H2,1H3,(H2,20,23,24) |
| InChIKey | SIJPYWAKKPZPKM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|