C9H15NO — CID 169269708
(2Z,4Z)-5-(methylamino)-3-propan-2-ylpenta-2,4-dienal (PubChem CID 169269708) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2Z,4Z)-5-(methylamino)-3-propan-2-ylpenta-2,4-dienal.
| Compound Name | (2Z,4Z)-5-(methylamino)-3-propan-2-ylpenta-2,4-dienal |
|---|---|
| PubChem CID | 169269708 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2Z,4Z)-5-(methylamino)-3-propan-2-ylpenta-2,4-dienal |
| SMILES | CN/C=C\C(=C/C=O)C(C)C |
| InChI | InChI=1S/C9H15NO/c1-8(2)9(5-7-11)4-6-10-3/h4-8,10H,1-3H3/b6-4-,9-5+ |
| InChIKey | YHLKLSNVYRRNTH-QUNSIMLLSA-N |
| XLogP | 1.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|