C30H26O4 — CID 169279879
1-[(2,7-dihydroxynaphthalen-1-yl)-(4-propylphenyl)methyl]naphthalene-2,7-diol (PubChem CID 169279879) has the molecular formula C30H26O4 and a molecular weight of 450.53 g/mol. Its IUPAC name is 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-propylphenyl)methyl]naphthalene-2,7-diol.
| Compound Name | 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-propylphenyl)methyl]naphthalene-2,7-diol |
|---|---|
| PubChem CID | 169279879 |
| Molecular Formula | C30H26O4 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-propylphenyl)methyl]naphthalene-2,7-diol |
| SMILES | CCCc1ccc(C(c2c(O)ccc3ccc(O)cc23)c2c(O)ccc3ccc(O)cc23)cc1 |
| InChI | InChI=1S/C30H26O4/c1-2-3-18-4-6-21(7-5-18)28(29-24-16-22(31)12-8-19(24)10-14-26(29)33)30-25-17-23(32)13-9-20(25)11-15-27(30)34/h4-17,28,31-34H,2-3H2,1H3 |
| InChIKey | HFPXKLUJCSDOGL-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|