C16H18F2O2 — CID 169282525
2-(3,4-difluorophenyl)but-3-yn-2-yl 2,2-dimethylbutanoate (PubChem CID 169282525) has the molecular formula C16H18F2O2 and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)but-3-yn-2-yl 2,2-dimethylbutanoate.
| Compound Name | 2-(3,4-difluorophenyl)but-3-yn-2-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 169282525 |
| Molecular Formula | C16H18F2O2 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-(3,4-difluorophenyl)but-3-yn-2-yl 2,2-dimethylbutanoate |
| SMILES | C#CC(C)(OC(=O)C(C)(C)CC)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H18F2O2/c1-6-15(3,4)14(19)20-16(5,7-2)11-8-9-12(17)13(18)10-11/h2,8-10H,6H2,1,3-5H3 |
| InChIKey | SAUINHBOCOFLLU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|