C23H23N3 — CID 169286897
4-[5-(3-tert-butyl-5-methylphenyl)-6-methylpyrazin-2-yl]benzonitrile (PubChem CID 169286897) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is 4-[5-(3-tert-butyl-5-methylphenyl)-6-methylpyrazin-2-yl]benzonitrile.
| Compound Name | 4-[5-(3-tert-butyl-5-methylphenyl)-6-methylpyrazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 169286897 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[5-(3-tert-butyl-5-methylphenyl)-6-methylpyrazin-2-yl]benzonitrile |
| SMILES | Cc1cc(-c2ncc(-c3ccc(C#N)cc3)nc2C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H23N3/c1-15-10-19(12-20(11-15)23(3,4)5)22-16(2)26-21(14-25-22)18-8-6-17(13-24)7-9-18/h6-12,14H,1-5H3 |
| InChIKey | APWGZCJDCSABCE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |