C31H31N3 — CID 140792673
4-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-butylbenzonitrile (PubChem CID 140792673) has the molecular formula C31H31N3 and a molecular weight of 445.61 g/mol. Its IUPAC name is 4-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-butylbenzonitrile.
| Compound Name | 4-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-butylbenzonitrile |
|---|---|
| PubChem CID | 140792673 |
| Molecular Formula | C31H31N3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 4-[5,6-bis(3,5-dimethylphenyl)pyrazin-2-yl]-3-butylbenzonitrile |
| SMILES | CCCCc1cc(C#N)ccc1-c1cnc(-c2cc(C)cc(C)c2)c(-c2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C31H31N3/c1-6-7-8-25-17-24(18-32)9-10-28(25)29-19-33-30(26-13-20(2)11-21(3)14-26)31(34-29)27-15-22(4)12-23(5)16-27/h9-17,19H,6-8H2,1-5H3 |
| InChIKey | MVVPZCMZWMHVKA-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |