C19H22N2O2 — CID 169298098
5-(3-aminopropyl)-N-(2,3-dihydro-1H-inden-1-yl)-2-hydroxybenzamide (PubChem CID 169298098) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 5-(3-aminopropyl)-N-(2,3-dihydro-1H-inden-1-yl)-2-hydroxybenzamide.
| Compound Name | 5-(3-aminopropyl)-N-(2,3-dihydro-1H-inden-1-yl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 169298098 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 5-(3-aminopropyl)-N-(2,3-dihydro-1H-inden-1-yl)-2-hydroxybenzamide |
| SMILES | NCCCc1ccc(O)c(C(=O)NC2CCc3ccccc32)c1 |
| InChI | InChI=1S/C19H22N2O2/c20-11-3-4-13-7-10-18(22)16(12-13)19(23)21-17-9-8-14-5-1-2-6-15(14)17/h1-2,5-7,10,12,17,22H,3-4,8-9,11,20H2,(H,21,23) |
| InChIKey | ZXGLPHHGIPMVRO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |