C16H25N4O4+ — CID 169300087
4-(hydroxymethyl)-5-[(2-methylpropan-2-yl)oxymethyl]-2-(7-methylpurin-9-ium-9-yl)oxolan-3-ol (PubChem CID 169300087) has the molecular formula C16H25N4O4+ and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-(hydroxymethyl)-5-[(2-methylpropan-2-yl)oxymethyl]-2-(7-methylpurin-9-ium-9-yl)oxolan-3-ol.
| Compound Name | 4-(hydroxymethyl)-5-[(2-methylpropan-2-yl)oxymethyl]-2-(7-methylpurin-9-ium-9-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 169300087 |
| Molecular Formula | C16H25N4O4+ |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-(hydroxymethyl)-5-[(2-methylpropan-2-yl)oxymethyl]-2-(7-methylpurin-9-ium-9-yl)oxolan-3-ol |
| SMILES | Cn1c[n+](C2OC(COC(C)(C)C)C(CO)C2O)c2ncncc21 |
| InChI | InChI=1S/C16H25N4O4/c1-16(2,3)23-7-12-10(6-21)13(22)15(24-12)20-9-19(4)11-5-17-8-18-14(11)20/h5,8-10,12-13,15,21-22H,6-7H2,1-4H3/q+1 |
| InChIKey | XEVFEPKNWDOAIC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|