C27H45B2N4O16P4+ — CID 174140959
CID 174140959 (PubChem CID 174140959) has the molecular formula C27H45B2N4O16P4+ and a molecular weight of 827.19 g/mol.
| Compound Name | CID 174140959 |
|---|---|
| PubChem CID | 174140959 |
| Molecular Formula | C27H45B2N4O16P4+ |
| Molecular Weight | 827.19 g/mol |
| Exact Mass | 827.20 |
| IUPAC Name | — |
| SMILES | [B]C1OC(COP(=C)(O)OC2C(COP(=O)(O)CP(=O)(O)OP(=O)(O)OCC3OC([n+]4cn(C)c5cncnc54)C(C)C3C)OC([B])C2C)C(O)C1C |
| InChI | InChI=1S/C27H44B2N4O16P4/c1-14-15(2)27(33-12-32(5)18-7-30-11-31-26(18)33)47-19(14)8-44-53(40,41)49-52(38,39)13-51(36,37)43-10-21-23(17(4)25(29)46-21)48-50(6,35)42-9-20-22(34)16(3)24(28)45-20/h7,11-12,14-17,19-25,27,34H,6,8-10,13H2,1-5H3,(H3-,35,36,37,38,39,40,41)/p+1 |
| InChIKey | BHCLFSJLHDWZOZ-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 260.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|