C15H23N4O4+ — CID 169300063
9-[4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one (PubChem CID 169300063) has the molecular formula C15H23N4O4+ and a molecular weight of 323.37 g/mol. Its IUPAC name is 9-[4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one.
| Compound Name | 9-[4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 169300063 |
| Molecular Formula | C15H23N4O4+ |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 9-[4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
| SMILES | Cn1c[n+](C2CC(O)C(COC(C)(C)C)O2)c2nc[nH]c(=O)c21 |
| InChI | InChI=1S/C15H22N4O4/c1-15(2,3)22-6-10-9(20)5-11(23-10)19-8-18(4)12-13(19)16-7-17-14(12)21/h7-11,20H,5-6H2,1-4H3/p+1 |
| InChIKey | SYLVLWCJNFLUNJ-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|