C20H34N4O7P+ — CID 137096208
[1-[3-hydroxy-5-(7-methyl-6-oxo-1H-purin-9-ium-9-yl)oxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid (PubChem CID 137096208) has the molecular formula C20H34N4O7P+ and a molecular weight of 473.49 g/mol. Its IUPAC name is [1-[3-hydroxy-5-(7-methyl-6-oxo-1H-purin-9-ium-9-yl)oxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid.
| Compound Name | [1-[3-hydroxy-5-(7-methyl-6-oxo-1H-purin-9-ium-9-yl)oxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid |
|---|---|
| PubChem CID | 137096208 |
| Molecular Formula | C20H34N4O7P+ |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [1-[3-hydroxy-5-(7-methyl-6-oxo-1H-purin-9-ium-9-yl)oxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid |
| SMILES | CCC(C)(CC1OC([n+]2cn(C)c3c(=O)[nH]cnc32)CC1O)OP(=O)(O)C(O)(CC)CC |
| InChI | InChI=1S/C20H33N4O7P/c1-6-19(4,31-32(28,29)20(27,7-2)8-3)10-14-13(25)9-15(30-14)24-12-23(5)16-17(24)21-11-22-18(16)26/h11-15,25,27H,6-10H2,1-5H3,(H-,21,22,26,28,29)/p+1 |
| InChIKey | VZUKGRYZDLGRIX-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|