C6H11N2O4+ — CID 169303360
[methyl-[(1Z,3E)-1,2,4-trihydroxypenta-1,3-dien-3-yl]amino]-oxoazanium (PubChem CID 169303360) has the molecular formula C6H11N2O4+ and a molecular weight of 175.16 g/mol. Its IUPAC name is [methyl-[(1Z,3E)-1,2,4-trihydroxypenta-1,3-dien-3-yl]amino]-oxoazanium.
| Compound Name | [methyl-[(1Z,3E)-1,2,4-trihydroxypenta-1,3-dien-3-yl]amino]-oxoazanium |
|---|---|
| PubChem CID | 169303360 |
| Molecular Formula | C6H11N2O4+ |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | [methyl-[(1Z,3E)-1,2,4-trihydroxypenta-1,3-dien-3-yl]amino]-oxoazanium |
| SMILES | C/C(O)=C(C(/O)=C/O)\N(C)[NH+]=O |
| InChI | InChI=1S/C6H10N2O4/c1-4(10)6(5(11)3-9)8(2)7-12/h3,9-11H,1-2H3/p+1/b5-3-,6-4+ |
| InChIKey | HSPVOLXSZQMWRW-CIIODKQPSA-O |
| XLogP | -0.57 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|