C30H60N2O3 — CID 169317552
5-[cyclohexyl(2-hydroxyethyl)amino]pentyl N,N-dioctylcarbamate (PubChem CID 169317552) has the molecular formula C30H60N2O3 and a molecular weight of 496.82 g/mol. Its IUPAC name is 5-[cyclohexyl(2-hydroxyethyl)amino]pentyl N,N-dioctylcarbamate.
| Compound Name | 5-[cyclohexyl(2-hydroxyethyl)amino]pentyl N,N-dioctylcarbamate |
|---|---|
| PubChem CID | 169317552 |
| Molecular Formula | C30H60N2O3 |
| Molecular Weight | 496.82 g/mol |
| Exact Mass | 496.46 |
| IUPAC Name | 5-[cyclohexyl(2-hydroxyethyl)amino]pentyl N,N-dioctylcarbamate |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)OCCCCCN(CCO)C1CCCCC1 |
| InChI | InChI=1S/C30H60N2O3/c1-3-5-7-9-11-17-24-32(25-18-12-10-8-6-4-2)30(34)35-28-20-14-19-23-31(26-27-33)29-21-15-13-16-22-29/h29,33H,3-28H2,1-2H3 |
| InChIKey | CNKHONXOKVXJNN-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.82 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|