C10H14N2OS — CID 169320687
N-(2-propan-2-yl-1,3-thiazol-5-yl)cyclopropanecarboxamide (PubChem CID 169320687) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is N-(2-propan-2-yl-1,3-thiazol-5-yl)cyclopropanecarboxamide.
| Compound Name | N-(2-propan-2-yl-1,3-thiazol-5-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 169320687 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N-(2-propan-2-yl-1,3-thiazol-5-yl)cyclopropanecarboxamide |
| SMILES | CC(C)c1ncc(NC(=O)C2CC2)s1 |
| InChI | InChI=1S/C10H14N2OS/c1-6(2)10-11-5-8(14-10)12-9(13)7-3-4-7/h5-7H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | QPTMGZDVQYHNMO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |