C17H18N4O5S — CID 169328039
4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-butylbenzenesulfonamide (PubChem CID 169328039) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-butylbenzenesulfonamide.
| Compound Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 169328039 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-butylbenzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C17H18N4O5S/c1-2-3-8-19-27(25,26)11-6-4-10(5-7-11)21-13(22)9-12-14(15(21)18)17(24)20-16(12)23/h4-7,9,19H,2-3,8,18H2,1H3,(H,20,23,24) |
| InChIKey | ZIFZSYKJURWEJH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|