C23H17NO4 — CID 169333799
2-[4-(5-formylfuran-2-yl)phenyl]-6,8-dimethylquinoline-4-carboxylic acid (PubChem CID 169333799) has the molecular formula C23H17NO4 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-[4-(5-formylfuran-2-yl)phenyl]-6,8-dimethylquinoline-4-carboxylic acid.
| Compound Name | 2-[4-(5-formylfuran-2-yl)phenyl]-6,8-dimethylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 169333799 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[4-(5-formylfuran-2-yl)phenyl]-6,8-dimethylquinoline-4-carboxylic acid |
| SMILES | Cc1cc(C)c2nc(-c3ccc(-c4ccc(C=O)o4)cc3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C23H17NO4/c1-13-9-14(2)22-18(10-13)19(23(26)27)11-20(24-22)15-3-5-16(6-4-15)21-8-7-17(12-25)28-21/h3-12H,1-2H3,(H,26,27) |
| InChIKey | ZNOXRNYLHGPTQZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|