About N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide
N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide (PubChem CID 169367095) has the molecular formula C16H14ClN3S
and a molecular weight of 315.83 g/mol. Its IUPAC name is N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide.
Molecular Properties
| Compound Name | N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide |
| PubChem CID | 169367095 |
| Molecular Formula | C16H14ClN3S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide |
| SMILES | Cc1ccc(-c2nc3ccccc3s2)cc1/N=C(/N)CCl |
| InChI | InChI=1S/C16H14ClN3S/c1-10-6-7-11(8-13(10)19-15(18)9-17)16-20-12-4-2-3-5-14(12)21-16/h2-8H,9H2,1H3,(H2,18,19) |
| InChIKey | DGPGFUOLGRLRTE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide?
The IUPAC name of N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide (CID 169367095) is N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide.
What is the SMILES notation for N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide?
The canonical SMILES for N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide is Cc1ccc(-c2nc3ccccc3s2)cc1/N=C(/N)CCl.
What is the InChIKey of N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide?
The InChIKey is DGPGFUOLGRLRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3S/c1-10-6-7-11(8-13(10)19-15(18)9-17)16-20-12-4-2-3-5-14(12)21-16/h2-8H,9H2,1H3,(H2,18,19).
What are the key properties of N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide?
N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide has a molecular weight of 315.83 g/mol, XLogP of 4.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloroethanimidamide is sourced from PubChem (CID 169367095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).