C15H12ClN3O3S2 — CID 169369084
4-[(1-amino-2-chloroethylidene)amino]-3-(1,3-benzothiazol-2-yl)benzenesulfonic acid (PubChem CID 169369084) has the molecular formula C15H12ClN3O3S2 and a molecular weight of 381.87 g/mol. Its IUPAC name is 4-[(1-amino-2-chloroethylidene)amino]-3-(1,3-benzothiazol-2-yl)benzenesulfonic acid.
| Compound Name | 4-[(1-amino-2-chloroethylidene)amino]-3-(1,3-benzothiazol-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 169369084 |
| Molecular Formula | C15H12ClN3O3S2 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 4-[(1-amino-2-chloroethylidene)amino]-3-(1,3-benzothiazol-2-yl)benzenesulfonic acid |
| SMILES | N/C(CCl)=N/c1ccc(S(=O)(=O)O)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H12ClN3O3S2/c16-8-14(17)18-11-6-5-9(24(20,21)22)7-10(11)15-19-12-3-1-2-4-13(12)23-15/h1-7H,8H2,(H2,17,18)(H,20,21,22) |
| InChIKey | MJLCAHGJXRNPIP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|