C14H15ClN2O2S — CID 169367370
ethyl 5-[(1-amino-2-chloroethylidene)amino]-3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 169367370) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is ethyl 5-[(1-amino-2-chloroethylidene)amino]-3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-[(1-amino-2-chloroethylidene)amino]-3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 169367370 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | ethyl 5-[(1-amino-2-chloroethylidene)amino]-3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2ccc(/N=C(/N)CCl)cc2c1C |
| InChI | InChI=1S/C14H15ClN2O2S/c1-3-19-14(18)13-8(2)10-6-9(17-12(16)7-15)4-5-11(10)20-13/h4-6H,3,7H2,1-2H3,(H2,16,17) |
| InChIKey | CBZYPRZKEVMXNW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|