C20H21NO5S — CID 169371438
N-[2-ethoxy-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 169371438) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[2-ethoxy-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-ethoxy-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169371438 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[2-ethoxy-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(-c2ccc(CO)o2)cc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO5S/c1-3-25-20-10-6-15(19-11-7-16(13-22)26-19)12-18(20)21-27(23,24)17-8-4-14(2)5-9-17/h4-12,21-22H,3,13H2,1-2H3 |
| InChIKey | LHRIPZVXXOKQJV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |