C19H15N11O3 — CID 169380368
[5,7-diamino-6-cyano-4-[4-[(4-nitropyrazol-1-yl)methoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380368) has the molecular formula C19H15N11O3 and a molecular weight of 445.40 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[4-[(4-nitropyrazol-1-yl)methoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[4-[(4-nitropyrazol-1-yl)methoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380368 |
| Molecular Formula | C19H15N11O3 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[4-[(4-nitropyrazol-1-yl)methoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2ccc(OCn3cc([N+](=O)[O-])cn3)cc2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C19H15N11O3/c20-5-13-15(22)14-16(26-19(24-8-21)28-18(14)27-17(13)23)10-1-3-12(4-2-10)33-9-29-7-11(6-25-29)30(31)32/h1-4,6-7,16H,9H2,(H6,22,23,24,26,27,28) |
| InChIKey | VDXUNSVVYVMZJN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 219.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|