C17H23N3 — CID 169384689
N,N-dimethyl-1-[3-[(2-phenylhydrazinyl)methyl]phenyl]ethanamine (PubChem CID 169384689) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-[(2-phenylhydrazinyl)methyl]phenyl]ethanamine.
| Compound Name | N,N-dimethyl-1-[3-[(2-phenylhydrazinyl)methyl]phenyl]ethanamine |
|---|---|
| PubChem CID | 169384689 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | N,N-dimethyl-1-[3-[(2-phenylhydrazinyl)methyl]phenyl]ethanamine |
| SMILES | CC(c1cccc(CNNc2ccccc2)c1)N(C)C |
| InChI | InChI=1S/C17H23N3/c1-14(20(2)3)16-9-7-8-15(12-16)13-18-19-17-10-5-4-6-11-17/h4-12,14,18-19H,13H2,1-3H3 |
| InChIKey | GSLACMVJLQAMFW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|