C30H27N3O5 — CID 169392390
ethyl 6-amino-5-cyano-4-[4-[6-(1,3-dioxoisoindol-2-yl)hex-1-ynyl]phenyl]-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169392390) has the molecular formula C30H27N3O5 and a molecular weight of 509.56 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-4-[4-[6-(1,3-dioxoisoindol-2-yl)hex-1-ynyl]phenyl]-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-4-[4-[6-(1,3-dioxoisoindol-2-yl)hex-1-ynyl]phenyl]-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169392390 |
| Molecular Formula | C30H27N3O5 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | ethyl 6-amino-5-cyano-4-[4-[6-(1,3-dioxoisoindol-2-yl)hex-1-ynyl]phenyl]-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(C#CCCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C30H27N3O5/c1-3-37-30(36)25-19(2)38-27(32)24(18-31)26(25)21-15-13-20(14-16-21)10-6-4-5-9-17-33-28(34)22-11-7-8-12-23(22)29(33)35/h7-8,11-16,26H,3-5,9,17,32H2,1-2H3 |
| InChIKey | PPKXLMSNVSSJLS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|