C24H21N7O3 — CID 169395618
2-amino-4-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169395618) has the molecular formula C24H21N7O3 and a molecular weight of 455.48 g/mol. Its IUPAC name is 2-amino-4-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169395618 |
| Molecular Formula | C24H21N7O3 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-amino-4-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccc(N2CCN(Cc3ccccc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21N7O3/c25-13-18-22(19(14-26)24(32)28-23(18)27)17-6-7-20(21(12-17)31(33)34)30-10-8-29(9-11-30)15-16-4-2-1-3-5-16/h1-7,12H,8-11,15H2,(H3,27,28,32) |
| InChIKey | KZUZRFWGCPBFAT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 156.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|