C18H19BrN4O4 — CID 169400845
tert-butyl 3-bromo-4-(5-ethoxycarbonyl-2H-triazol-4-yl)indole-1-carboxylate (PubChem CID 169400845) has the molecular formula C18H19BrN4O4 and a molecular weight of 435.28 g/mol. Its IUPAC name is tert-butyl 3-bromo-4-(5-ethoxycarbonyl-2H-triazol-4-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-bromo-4-(5-ethoxycarbonyl-2H-triazol-4-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 169400845 |
| Molecular Formula | C18H19BrN4O4 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | tert-butyl 3-bromo-4-(5-ethoxycarbonyl-2H-triazol-4-yl)indole-1-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cccc2c1c(Br)cn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H19BrN4O4/c1-5-26-16(24)15-14(20-22-21-15)10-7-6-8-12-13(10)11(19)9-23(12)17(25)27-18(2,3)4/h6-9H,5H2,1-4H3,(H,20,21,22) |
| InChIKey | KOJQROGRSPYUNA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |