C31H39ClN4O5 — CID 169411083
(4S,7R)-9-[1-(4-chlorophenyl)cyclobutanecarbonyl]-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-2,5,11-trione (PubChem CID 169411083) has the molecular formula C31H39ClN4O5 and a molecular weight of 583.13 g/mol. Its IUPAC name is (4S,7R)-9-[1-(4-chlorophenyl)cyclobutanecarbonyl]-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-2,5,11-trione.
| Compound Name | (4S,7R)-9-[1-(4-chlorophenyl)cyclobutanecarbonyl]-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-2,5,11-trione |
|---|---|
| PubChem CID | 169411083 |
| Molecular Formula | C31H39ClN4O5 |
| Molecular Weight | 583.13 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | (4S,7R)-9-[1-(4-chlorophenyl)cyclobutanecarbonyl]-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-2,5,11-trione |
| SMILES | Cc1ccc2cc1CCCNC(=O)CN(C(=O)C1(c3ccc(Cl)cc3)CCC1)C[C@@H](C)NC(=O)[C@H]([C@@H](C)O)NC2=O |
| InChI | InChI=1S/C31H39ClN4O5/c1-19-7-8-23-16-22(19)6-4-15-33-26(38)18-36(17-20(2)34-29(40)27(21(3)37)35-28(23)39)30(41)31(13-5-14-31)24-9-11-25(32)12-10-24/h7-12,16,20-21,27,37H,4-6,13-15,17-18H2,1-3H3,(H,33,38)(H,34,40)(H,35,39)/t20-,21-,27+/m1/s1 |
| InChIKey | YJNIWZDSIJXWFM-GNMOFYLKSA-N |
| XLogP | 2.65 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |