C26H38N4O7 — CID 169421168
methyl 5-[(4S,7R)-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-2,5,11-trioxo-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-trien-9-yl]-5-oxopentanoate (PubChem CID 169421168) has the molecular formula C26H38N4O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is methyl 5-[(4S,7R)-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-2,5,11-trioxo-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-trien-9-yl]-5-oxopentanoate.
| Compound Name | methyl 5-[(4S,7R)-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-2,5,11-trioxo-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-trien-9-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 169421168 |
| Molecular Formula | C26H38N4O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | methyl 5-[(4S,7R)-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-2,5,11-trioxo-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-trien-9-yl]-5-oxopentanoate |
| SMILES | COC(=O)CCCC(=O)N1CC(=O)NCCCc2cc(ccc2C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@H](C)C1 |
| InChI | InChI=1S/C26H38N4O7/c1-16-10-11-20-13-19(16)7-6-12-27-21(32)15-30(22(33)8-5-9-23(34)37-4)14-17(2)28-26(36)24(18(3)31)29-25(20)35/h10-11,13,17-18,24,31H,5-9,12,14-15H2,1-4H3,(H,27,32)(H,28,36)(H,29,35)/t17-,18-,24+/m1/s1 |
| InChIKey | ZYIVAUBOCJHSFV-GGUMNFRJSA-N |
| XLogP | 0.21 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |