C26H32N6O5 — CID 169422516
5-[(4S,7R)-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-2,5,11-trioxo-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-9-carbonyl]-1H-pyrrole-3-carbonitrile (PubChem CID 169422516) has the molecular formula C26H32N6O5 and a molecular weight of 508.58 g/mol. Its IUPAC name is 5-[(4S,7R)-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-2,5,11-trioxo-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-9-carbonyl]-1H-pyrrole-3-carbonitrile.
| Compound Name | 5-[(4S,7R)-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-2,5,11-trioxo-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-9-carbonyl]-1H-pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 169422516 |
| Molecular Formula | C26H32N6O5 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 5-[(4S,7R)-4-[(1R)-1-hydroxyethyl]-7,17-dimethyl-2,5,11-trioxo-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-9-carbonyl]-1H-pyrrole-3-carbonitrile |
| SMILES | Cc1ccc2cc1CCCNC(=O)CN(C(=O)c1cc(C#N)c[nH]1)C[C@@H](C)NC(=O)[C@H]([C@@H](C)O)NC2=O |
| InChI | InChI=1S/C26H32N6O5/c1-15-6-7-20-10-19(15)5-4-8-28-22(34)14-32(26(37)21-9-18(11-27)12-29-21)13-16(2)30-25(36)23(17(3)33)31-24(20)35/h6-7,9-10,12,16-17,23,29,33H,4-5,8,13-14H2,1-3H3,(H,28,34)(H,30,36)(H,31,35)/t16-,17-,23+/m1/s1 |
| InChIKey | QDLOCISQEGRPNB-QZMQVMSPSA-N |
| XLogP | 0.38 |
| TPSA | 167.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |