C13H18NO7S2- — CID 169431815
(E,3S)-3-amino-5-methylsulfonylpent-4-enoic acid;4-methylbenzenesulfonate (PubChem CID 169431815) has the molecular formula C13H18NO7S2- and a molecular weight of 364.42 g/mol. Its IUPAC name is (E,3S)-3-amino-5-methylsulfonylpent-4-enoic acid;4-methylbenzenesulfonate.
| Compound Name | (E,3S)-3-amino-5-methylsulfonylpent-4-enoic acid;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169431815 |
| Molecular Formula | C13H18NO7S2- |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | (E,3S)-3-amino-5-methylsulfonylpent-4-enoic acid;4-methylbenzenesulfonate |
| SMILES | CS(=O)(=O)/C=C/[C@@H](N)CC(=O)O.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C6H11NO4S/c1-6-2-4-7(5-3-6)11(8,9)10;1-12(10,11)3-2-5(7)4-6(8)9/h2-5H,1H3,(H,8,9,10);2-3,5H,4,7H2,1H3,(H,8,9)/p-1/b;3-2+/t;5-/m.1/s1 |
| InChIKey | YKWYHXZFGZZIJW-BDIDFECCSA-M |
| XLogP | 0.25 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|