C18H29NO7S2 — CID 159441309
4-methylbenzenesulfonate;[(E,3S)-6-[(2-methylpropan-2-yl)oxy]-1-methylsulfonyl-6-oxohex-1-en-3-yl]azanium (PubChem CID 159441309) has the molecular formula C18H29NO7S2 and a molecular weight of 435.56 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;[(E,3S)-6-[(2-methylpropan-2-yl)oxy]-1-methylsulfonyl-6-oxohex-1-en-3-yl]azanium.
| Compound Name | 4-methylbenzenesulfonate;[(E,3S)-6-[(2-methylpropan-2-yl)oxy]-1-methylsulfonyl-6-oxohex-1-en-3-yl]azanium |
|---|---|
| PubChem CID | 159441309 |
| Molecular Formula | C18H29NO7S2 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-methylbenzenesulfonate;[(E,3S)-6-[(2-methylpropan-2-yl)oxy]-1-methylsulfonyl-6-oxohex-1-en-3-yl]azanium |
| SMILES | CC(C)(C)OC(=O)CC[C@H]([NH3+])/C=C/S(C)(=O)=O.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H21NO4S.C7H8O3S/c1-11(2,3)16-10(13)6-5-9(12)7-8-17(4,14)15;1-6-2-4-7(5-3-6)11(8,9)10/h7-9H,5-6,12H2,1-4H3;2-5H,1H3,(H,8,9,10)/b8-7+;/t9-;/m0./s1 |
| InChIKey | SNULHGHMKFFVMZ-CKAKWYRNSA-N |
| XLogP | 1.18 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|