About (5-oxopyrrolidin-2-yl) benzenesulfinate
(5-oxopyrrolidin-2-yl) benzenesulfinate (PubChem CID 169434056) has the molecular formula C10H11NO3S
and a molecular weight of 225.27 g/mol. Its IUPAC name is (5-oxopyrrolidin-2-yl) benzenesulfinate.
Molecular Properties
| Compound Name | (5-oxopyrrolidin-2-yl) benzenesulfinate |
| PubChem CID | 169434056 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | (5-oxopyrrolidin-2-yl) benzenesulfinate |
| SMILES | O=C1CCC(OS(=O)c2ccccc2)N1 |
| InChI | InChI=1S/C10H11NO3S/c12-9-6-7-10(11-9)14-15(13)8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,11,12) |
| InChIKey | ODGMVZPHOBNCLW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-oxopyrrolidin-2-yl) benzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxopyrrolidin-2-yl) benzenesulfinate?
The IUPAC name of (5-oxopyrrolidin-2-yl) benzenesulfinate (CID 169434056) is (5-oxopyrrolidin-2-yl) benzenesulfinate.
What is the SMILES notation for (5-oxopyrrolidin-2-yl) benzenesulfinate?
The canonical SMILES for (5-oxopyrrolidin-2-yl) benzenesulfinate is O=C1CCC(OS(=O)c2ccccc2)N1.
What is the InChIKey of (5-oxopyrrolidin-2-yl) benzenesulfinate?
The InChIKey is ODGMVZPHOBNCLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3S/c12-9-6-7-10(11-9)14-15(13)8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,11,12).
What are the key properties of (5-oxopyrrolidin-2-yl) benzenesulfinate?
(5-oxopyrrolidin-2-yl) benzenesulfinate has a molecular weight of 225.27 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxopyrrolidin-2-yl) benzenesulfinate is sourced from PubChem (CID 169434056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).