About (3-fluorocyclohexyl) benzenesulfinate
(3-fluorocyclohexyl) benzenesulfinate (PubChem CID 68780735) has the molecular formula C12H15FO2S
and a molecular weight of 242.31 g/mol. Its IUPAC name is (3-fluorocyclohexyl) benzenesulfinate.
Molecular Properties
| Compound Name | (3-fluorocyclohexyl) benzenesulfinate |
| PubChem CID | 68780735 |
| Molecular Formula | C12H15FO2S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (3-fluorocyclohexyl) benzenesulfinate |
| SMILES | O=S(OC1CCCC(F)C1)c1ccccc1 |
| InChI | InChI=1S/C12H15FO2S/c13-10-5-4-6-11(9-10)15-16(14)12-7-2-1-3-8-12/h1-3,7-8,10-11H,4-6,9H2 |
| InChIKey | FKEWAMRJAPRWCK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-fluorocyclohexyl) benzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorocyclohexyl) benzenesulfinate?
The IUPAC name of (3-fluorocyclohexyl) benzenesulfinate (CID 68780735) is (3-fluorocyclohexyl) benzenesulfinate.
What is the SMILES notation for (3-fluorocyclohexyl) benzenesulfinate?
The canonical SMILES for (3-fluorocyclohexyl) benzenesulfinate is O=S(OC1CCCC(F)C1)c1ccccc1.
What is the InChIKey of (3-fluorocyclohexyl) benzenesulfinate?
The InChIKey is FKEWAMRJAPRWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO2S/c13-10-5-4-6-11(9-10)15-16(14)12-7-2-1-3-8-12/h1-3,7-8,10-11H,4-6,9H2.
What are the key properties of (3-fluorocyclohexyl) benzenesulfinate?
(3-fluorocyclohexyl) benzenesulfinate has a molecular weight of 242.31 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorocyclohexyl) benzenesulfinate is sourced from PubChem (CID 68780735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).