C18H20ClNO4S — CID 169434202
benzyl N-[(2R,3S)-1-(benzenesulfinyl)-4-chloro-3-hydroxybutan-2-yl]carbamate (PubChem CID 169434202) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is benzyl N-[(2R,3S)-1-(benzenesulfinyl)-4-chloro-3-hydroxybutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R,3S)-1-(benzenesulfinyl)-4-chloro-3-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 169434202 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | benzyl N-[(2R,3S)-1-(benzenesulfinyl)-4-chloro-3-hydroxybutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](CS(=O)c1ccccc1)[C@H](O)CCl)OCc1ccccc1 |
| InChI | InChI=1S/C18H20ClNO4S/c19-11-17(21)16(13-25(23)15-9-5-2-6-10-15)20-18(22)24-12-14-7-3-1-4-8-14/h1-10,16-17,21H,11-13H2,(H,20,22)/t16-,17+,25?/m0/s1 |
| InChIKey | KBDWMAUGPYBOBG-WAPIFTKLSA-N |
| XLogP | 2.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|