C26H24ClN3O3 — CID 169441369
5-[[4-(13-chloro-9-hydroxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methyl]pyridine-3-carboxylic acid (PubChem CID 169441369) has the molecular formula C26H24ClN3O3 and a molecular weight of 461.95 g/mol. Its IUPAC name is 5-[[4-(13-chloro-9-hydroxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methyl]pyridine-3-carboxylic acid.
| Compound Name | 5-[[4-(13-chloro-9-hydroxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 169441369 |
| Molecular Formula | C26H24ClN3O3 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 5-[[4-(13-chloro-9-hydroxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(CN2CCC(=C3c4ccc(Cl)cc4CC(O)c4cccnc43)CC2)c1 |
| InChI | InChI=1S/C26H24ClN3O3/c27-20-3-4-21-18(11-20)12-23(31)22-2-1-7-29-25(22)24(21)17-5-8-30(9-6-17)15-16-10-19(26(32)33)14-28-13-16/h1-4,7,10-11,13-14,23,31H,5-6,8-9,12,15H2,(H,32,33) |
| InChIKey | VTPOMQSSPBNDRC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |