C28H28ClN3O2 — CID 89476006
ethyl 2-[[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methyl]pyridine-4-carboxylate (PubChem CID 89476006) has the molecular formula C28H28ClN3O2 and a molecular weight of 474.00 g/mol. Its IUPAC name is ethyl 2-[[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methyl]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 89476006 |
| Molecular Formula | C28H28ClN3O2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | ethyl 2-[[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methyl]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(CN2CCC(=C3c4ccc(Cl)cc4CCc4cccnc43)CC2)c1 |
| InChI | InChI=1S/C28H28ClN3O2/c1-2-34-28(33)22-9-13-30-24(17-22)18-32-14-10-19(11-15-32)26-25-8-7-23(29)16-21(25)6-5-20-4-3-12-31-27(20)26/h3-4,7-9,12-13,16-17H,2,5-6,10-11,14-15,18H2,1H3 |
| InChIKey | DAJCOUCBIDQRSG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |