C9H10N2 — CID 169442467
(4,5,6,7-tetradeuterio-1H-indol-3-yl)methanamine (PubChem CID 169442467) has the molecular formula C9H10N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (4,5,6,7-tetradeuterio-1H-indol-3-yl)methanamine.
| Compound Name | (4,5,6,7-tetradeuterio-1H-indol-3-yl)methanamine |
|---|---|
| PubChem CID | 169442467 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.11 |
| IUPAC Name | (4,5,6,7-tetradeuterio-1H-indol-3-yl)methanamine |
| SMILES | [2H]c1c([2H])c([2H])c2c(CN)c[nH]c2c1[2H] |
| InChI | InChI=1S/C9H10N2/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5,10H2/i1D,2D,3D,4D |
| InChIKey | JXYGLMATGAAIBU-RHQRLBAQSA-N |
| XLogP | 1.63 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |