C4H3NO6S — CID 169451887
2,2,4,5-tetraoxooxathiazinane-6-carbaldehyde (PubChem CID 169451887) has the molecular formula C4H3NO6S and a molecular weight of 193.14 g/mol. Its IUPAC name is 2,2,4,5-tetraoxooxathiazinane-6-carbaldehyde.
| Compound Name | 2,2,4,5-tetraoxooxathiazinane-6-carbaldehyde |
|---|---|
| PubChem CID | 169451887 |
| Molecular Formula | C4H3NO6S |
| Molecular Weight | 193.14 g/mol |
| Exact Mass | 192.97 |
| IUPAC Name | 2,2,4,5-tetraoxooxathiazinane-6-carbaldehyde |
| SMILES | O=CC1OS(=O)(=O)NC(=O)C1=O |
| InChI | InChI=1S/C4H3NO6S/c6-1-2-3(7)4(8)5-12(9,10)11-2/h1-2H,(H,5,8) |
| InChIKey | ZNJBIGSZMCUZKB-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.14 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|