C22H14BrNO3 — CID 169452341
6-(2-bromophenyl)-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),11,13,15,17-hexaene-4,8-dione (PubChem CID 169452341) has the molecular formula C22H14BrNO3 and a molecular weight of 420.26 g/mol. Its IUPAC name is 6-(2-bromophenyl)-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),11,13,15,17-hexaene-4,8-dione.
| Compound Name | 6-(2-bromophenyl)-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),11,13,15,17-hexaene-4,8-dione |
|---|---|
| PubChem CID | 169452341 |
| Molecular Formula | C22H14BrNO3 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 6-(2-bromophenyl)-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),11,13,15,17-hexaene-4,8-dione |
| SMILES | O=C1CC(c2ccccc2Br)c2c(c3ccc4ccccc4c3[nH]c2=O)O1 |
| InChI | InChI=1S/C22H14BrNO3/c23-17-8-4-3-7-14(17)16-11-18(25)27-21-15-10-9-12-5-1-2-6-13(12)20(15)24-22(26)19(16)21/h1-10,16H,11H2,(H,24,26) |
| InChIKey | ACHTTWSXNNOWHM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|