C8H7BrN2O — CID 169496974
6-bromo-4-methyl-1,2-benzoxazol-3-amine (PubChem CID 169496974) has the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. Its IUPAC name is 6-bromo-4-methyl-1,2-benzoxazol-3-amine.
| Compound Name | 6-bromo-4-methyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 169496974 |
| Molecular Formula | C8H7BrN2O |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.97 |
| IUPAC Name | 6-bromo-4-methyl-1,2-benzoxazol-3-amine |
| SMILES | Cc1cc(Br)cc2onc(N)c12 |
| InChI | InChI=1S/C8H7BrN2O/c1-4-2-5(9)3-6-7(4)8(10)11-12-6/h2-3H,1H3,(H2,10,11) |
| InChIKey | GBNKHSPIEHIHFH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |