C22H36Br2N2Si2 — CID 161284183
4-bromo-2,6-dimethylaniline;4-bromo-2,6-dimethyl-N,N-bis(trimethylsilyl)aniline (PubChem CID 161284183) has the molecular formula C22H36Br2N2Si2 and a molecular weight of 544.52 g/mol. Its IUPAC name is 4-bromo-2,6-dimethylaniline;4-bromo-2,6-dimethyl-N,N-bis(trimethylsilyl)aniline.
| Compound Name | 4-bromo-2,6-dimethylaniline;4-bromo-2,6-dimethyl-N,N-bis(trimethylsilyl)aniline |
|---|---|
| PubChem CID | 161284183 |
| Molecular Formula | C22H36Br2N2Si2 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | 4-bromo-2,6-dimethylaniline;4-bromo-2,6-dimethyl-N,N-bis(trimethylsilyl)aniline |
| SMILES | Cc1cc(Br)cc(C)c1N.Cc1cc(Br)cc(C)c1N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H26BrNSi2.C8H10BrN/c1-11-9-13(15)10-12(2)14(11)16(17(3,4)5)18(6,7)8;1-5-3-7(9)4-6(2)8(5)10/h9-10H,1-8H3;3-4H,10H2,1-2H3 |
| InChIKey | VFMMPVAHKFSRER-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|