C25H21N3O5S — CID 16961587
(5Z)-3-(3,5-dimethylphenyl)-5-[(4-methoxyphenyl)methylidene]-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanylimidazol-4-one (PubChem CID 16961587) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is (5Z)-3-(3,5-dimethylphenyl)-5-[(4-methoxyphenyl)methylidene]-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanylimidazol-4-one.
| Compound Name | (5Z)-3-(3,5-dimethylphenyl)-5-[(4-methoxyphenyl)methylidene]-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanylimidazol-4-one |
|---|---|
| PubChem CID | 16961587 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | (5Z)-3-(3,5-dimethylphenyl)-5-[(4-methoxyphenyl)methylidene]-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]sulfanylimidazol-4-one |
| SMILES | COc1ccc(/C=C2\N=C(S/C=C/c3ccc([N+](=O)[O-])o3)N(c3cc(C)cc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H21N3O5S/c1-16-12-17(2)14-19(13-16)27-24(29)22(15-18-4-6-20(32-3)7-5-18)26-25(27)34-11-10-21-8-9-23(33-21)28(30)31/h4-15H,1-3H3/b11-10+,22-15- |
| InChIKey | FMKOGAOCMMDBGB-PIIHAJGSSA-N |
| XLogP | 5.96 |
| TPSA | 98.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|