C12H23F4P — CID 170023682
(1,1,1,3-tetrafluoro-2,2,4,4,5,5-hexamethylhexan-3-yl)phosphane (PubChem CID 170023682) has the molecular formula C12H23F4P and a molecular weight of 274.28 g/mol. Its IUPAC name is (1,1,1,3-tetrafluoro-2,2,4,4,5,5-hexamethylhexan-3-yl)phosphane.
| Compound Name | (1,1,1,3-tetrafluoro-2,2,4,4,5,5-hexamethylhexan-3-yl)phosphane |
|---|---|
| PubChem CID | 170023682 |
| Molecular Formula | C12H23F4P |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (1,1,1,3-tetrafluoro-2,2,4,4,5,5-hexamethylhexan-3-yl)phosphane |
| SMILES | CC(C)(C)C(C)(C)C(F)(P)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C12H23F4P/c1-8(2,3)9(4,5)11(13,17)10(6,7)12(14,15)16/h17H2,1-7H3 |
| InChIKey | HOEWEUVDXXFTKQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|