C12H18N2O6 — CID 170027940
2-(butanoylamino)ethyl N-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]carbamate (PubChem CID 170027940) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-(butanoylamino)ethyl N-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]carbamate.
| Compound Name | 2-(butanoylamino)ethyl N-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 170027940 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-(butanoylamino)ethyl N-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]carbamate |
| SMILES | CCCC(=O)NCCOC(=O)NCc1oc(=O)oc1C |
| InChI | InChI=1S/C12H18N2O6/c1-3-4-10(15)13-5-6-18-11(16)14-7-9-8(2)19-12(17)20-9/h3-7H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | KSCOBRWXYVYJHK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|