C38H72N2 — CID 170031345
N-(8-methylideneoctadecyl)-N-(8-methylnon-8-enyl)-N'-[(Z)-prop-1-enyl]-N'-prop-1-en-2-ylpropane-1,3-diamine (PubChem CID 170031345) has the molecular formula C38H72N2 and a molecular weight of 557.01 g/mol. Its IUPAC name is N-(8-methylideneoctadecyl)-N-(8-methylnon-8-enyl)-N'-[(Z)-prop-1-enyl]-N'-prop-1-en-2-ylpropane-1,3-diamine.
| Compound Name | N-(8-methylideneoctadecyl)-N-(8-methylnon-8-enyl)-N'-[(Z)-prop-1-enyl]-N'-prop-1-en-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 170031345 |
| Molecular Formula | C38H72N2 |
| Molecular Weight | 557.01 g/mol |
| Exact Mass | 556.57 |
| IUPAC Name | N-(8-methylideneoctadecyl)-N-(8-methylnon-8-enyl)-N'-[(Z)-prop-1-enyl]-N'-prop-1-en-2-ylpropane-1,3-diamine |
| SMILES | C=C(C)CCCCCCCN(CCCCCCCC(=C)CCCCCCCCCC)CCCN(/C=C\C)C(=C)C |
| InChI | InChI=1S/C38H72N2/c1-8-10-11-12-13-14-18-23-29-38(7)30-24-19-16-21-26-33-39(32-25-20-15-17-22-28-36(3)4)34-27-35-40(31-9-2)37(5)6/h9,31H,3,5,7-8,10-30,32-35H2,1-2,4,6H3/b31-9- |
| InChIKey | HBXIFOJPLSPDQW-YSGASBTCSA-N |
| XLogP | 12.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.01 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|