C10H14O4 — CID 170031448
dimethyl bicyclo[2.1.1]hexane-1,3-dicarboxylate (PubChem CID 170031448) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is dimethyl bicyclo[2.1.1]hexane-1,3-dicarboxylate.
| Compound Name | dimethyl bicyclo[2.1.1]hexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 170031448 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | dimethyl bicyclo[2.1.1]hexane-1,3-dicarboxylate |
| SMILES | COC(=O)C1CC2(C(=O)OC)CC1C2 |
| InChI | InChI=1S/C10H14O4/c1-13-8(11)7-5-10(9(12)14-2)3-6(7)4-10/h6-7H,3-5H2,1-2H3 |
| InChIKey | SGEJRSKSPIZVPZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |