C11H14N2O3 — CID 170035397
(2S,3R)-2-amino-3-hydroxy-N-oxo-5-phenylpentanamide (PubChem CID 170035397) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-N-oxo-5-phenylpentanamide.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-N-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 170035397 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-N-oxo-5-phenylpentanamide |
| SMILES | N[C@H](C(=O)N=O)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C11H14N2O3/c12-10(11(15)13-16)9(14)7-6-8-4-2-1-3-5-8/h1-5,9-10,14H,6-7,12H2/t9-,10+/m1/s1 |
| InChIKey | BAZHRMGGJXCKJT-ZJUUUORDSA-N |
| XLogP | 0.60 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |