C30H32ClN5O3 — CID 170036249
5-(2-chlorophenyl)-N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide (PubChem CID 170036249) has the molecular formula C30H32ClN5O3 and a molecular weight of 546.07 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide |
|---|---|
| PubChem CID | 170036249 |
| Molecular Formula | C30H32ClN5O3 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 5-(2-chlorophenyl)-N-[4-[5-(4-hydroxy-4-methylpentoxy)-2-methylphenyl]-2-pyridinyl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide |
| SMILES | Cc1ccc(OCCCC(C)(C)O)cc1-c1ccnc(NC(=O)c2nc3n(n2)C(c2ccccc2Cl)CC3)c1 |
| InChI | InChI=1S/C30H32ClN5O3/c1-19-9-10-21(39-16-6-14-30(2,3)38)18-23(19)20-13-15-32-26(17-20)33-29(37)28-34-27-12-11-25(36(27)35-28)22-7-4-5-8-24(22)31/h4-5,7-10,13,15,17-18,25,38H,6,11-12,14,16H2,1-3H3,(H,32,33,37) |
| InChIKey | RLUCVLYSDGIHRM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|