C16H22BrNO2S — CID 170049015
N-[(3E)-3-bromo-5,6-dimethylhepta-1,3-dien-2-yl]-4-methylbenzenesulfonamide (PubChem CID 170049015) has the molecular formula C16H22BrNO2S and a molecular weight of 372.33 g/mol. Its IUPAC name is N-[(3E)-3-bromo-5,6-dimethylhepta-1,3-dien-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3E)-3-bromo-5,6-dimethylhepta-1,3-dien-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 170049015 |
| Molecular Formula | C16H22BrNO2S |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-[(3E)-3-bromo-5,6-dimethylhepta-1,3-dien-2-yl]-4-methylbenzenesulfonamide |
| SMILES | C=C(NS(=O)(=O)c1ccc(C)cc1)/C(Br)=C\C(C)C(C)C |
| InChI | InChI=1S/C16H22BrNO2S/c1-11(2)13(4)10-16(17)14(5)18-21(19,20)15-8-6-12(3)7-9-15/h6-11,13,18H,5H2,1-4H3/b16-10+ |
| InChIKey | STFSWVZYIUYAHI-MHWRWJLKSA-N |
| XLogP | 4.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|